![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1611635006_assessing-the-judiciarys-role-in-access-to-safe-abortion.pdf | 2021-01-26 09:53 | 12M | |
![[ ]](/icons/layout.gif) | 1612296400_Ensuring Reproductive Rights.pdf | 2021-02-03 01:36 | 6.6M | |
![[ ]](/icons/layout.gif) | 1622100664_BA, Ch 3 - YP Stories.pdf | 2021-05-27 13:01 | 5.0M | |
![[IMG]](/icons/image2.gif) | 1616074418_user_DSC_3868.jpg | 2021-03-18 19:03 | 5.0M | |
![[ ]](/icons/layout.gif) | 1615892760_BA, Ch 1 - What is Advocacy.pdf | 2021-03-16 16:36 | 3.6M | |
![[ ]](/icons/layout.gif) | 1615892331_BA, Ch 1 - What is Advocacy.pdf | 2021-03-16 16:28 | 3.6M | |
![[ ]](/icons/layout.gif) | 1615891336_BA, Ch 1 - What is Advocacy.pdf | 2021-03-16 16:12 | 3.6M | |
![[IMG]](/icons/image2.gif) | 1610526328_user_2020-12-28-082321304.jpg | 2021-01-13 13:55 | 3.1M | |
![[ ]](/icons/layout.gif) | Ending pregnancy with pills IPAS.pdf | 2021-01-12 18:06 | 2.7M | |
![[ ]](/icons/layout.gif) | Ending pregnancy with pills IPAS (1) (2).pdf | 2021-01-12 18:06 | 2.7M | |
![[ ]](/icons/layout.gif) | 1612296400_Exclaim! Young People’s Guide to “Sexual Rights_ An IPPF Declaration’.pdf | 2021-02-03 01:36 | 2.7M | |
![[ ]](/icons/unknown.gif) | 1635398491_Messaging on Abortion_TYPF_24Oct2021 (1).ppt | 2021-10-28 10:51 | 2.4M | |
![[IMG]](/icons/image2.gif) | 1610459715_course_2711_R0lVIERBTiA1ODUtMDM.jpg | 2021-01-12 19:25 | 2.3M | |
![[ ]](/icons/layout.gif) | Contraception_Updated_English.pdf | 2021-01-12 18:37 | 2.1M | |
![[ ]](/icons/layout.gif) | 1611909603_Contraception_Updated_English (1) (1).pdf | 2021-01-29 14:10 | 2.1M | |
![[ ]](/icons/layout.gif) | 1611836676_Contraception_Updated_English.pdf | 2021-01-28 17:54 | 2.1M | |
![[IMG]](/icons/image2.gif) | 1610459742_course_2711_R0lVIERBTiA1ODUtMTI.jpg | 2021-01-12 19:25 | 1.7M | |
![[ ]](/icons/layout.gif) | 1617083840_BA, Ch 2 - How to be an Effective Advocate.pdf | 2021-03-30 11:27 | 1.5M | |
![[ ]](/icons/layout.gif) | 1613145272_Abortion-Stigma-Around-the-World-A-synthesis-of-qualitative-literature-_Global-Health-Visions-2016.pdf | 2021-02-12 21:24 | 1.5M | |
![[ ]](/icons/layout.gif) | 1612961755_Abortion-Stigma-Around-the-World-A-synthesis-of-qualitative-literature-_Global-Health-Visions-2016.pdf | 2021-02-10 18:25 | 1.5M | |
![[ ]](/icons/layout.gif) | 1635398491_CREA_Abort-The-Stigma_Abortion-Toolkit-2020_English-min.pdf | 2021-10-28 10:51 | 1.4M | |
![[ ]](/icons/layout.gif) | 1611635006_Abortion Law, Policy and Services in India- A Critical Review.pdf | 2021-01-26 09:53 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1626775757_course_SAAF logo.jpg | 2021-07-20 15:39 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1622625807_course_SAAF logo.jpg | 2021-06-02 14:53 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1622543136_course_SAAF logo.jpg | 2021-06-01 15:55 | 1.3M | |
![[IMG]](/icons/image2.gif) | 1622458003_course_SAAF logo.jpg | 2021-05-31 16:16 | 1.3M | |
![[ ]](/icons/layout.gif) | 1611636679_ABORTION LAWS IN INDIA- A REVIEW OF COURT CASES.pdf | 2021-01-26 10:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | 1622546794_course_SAAF logo.png | 2021-06-01 16:56 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1622458056_course_SAAF logo.png | 2021-05-31 16:17 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1622457646_course_SAAF logo.png | 2021-05-31 16:10 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1622457566_course_SAAF logo.png | 2021-05-31 16:09 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1622457909_course_SAAF logo.jpg | 2021-05-31 16:15 | 1.0M | |
![[IMG]](/icons/image2.gif) | 1614590786_user_Neelam photo.jpg | 2021-03-01 14:56 | 927K | |
![[ ]](/icons/layout.gif) | 1612280078_improving-access-to-comprehensive-abortion-care-in-india-with-focus-on-expanding-provider-base-a-policy-brief-ipas-development-foundation (1).pdf | 2021-02-02 21:04 | 926K | |
![[IMG]](/icons/image2.gif) | 1630346501_user_Chrysanthemum.jpg | 2021-08-30 23:31 | 859K | |
![[IMG]](/icons/image2.gif) | 1629370334_course_1610457028_course_track 2 icon.png | 2021-08-19 16:22 | 717K | |
![[IMG]](/icons/image2.gif) | 1610457028_course_track 2 icon.png | 2021-01-12 18:40 | 717K | |
![[ ]](/icons/layout.gif) | 1611635156_The MTP 2020 Amendment Bill anti rights subjectivity.pdf | 2021-01-26 09:55 | 708K | |
![[ ]](/icons/layout.gif) | 1613145399_how to talk about abortion.pdf | 2021-02-12 21:26 | 639K | |
![[ ]](/icons/layout.gif) | 1631645105_Post Module 2_Assignment.pdf | 2021-09-15 00:15 | 638K | |
![[IMG]](/icons/image2.gif) | 1610461558_user_wx_camera_1510377217400.jpg | 2021-01-12 19:55 | 621K | |
![[ ]](/icons/layout.gif) | Contraceptives' chart.pdf | 2021-01-12 18:37 | 544K | |
![[ ]](/icons/layout.gif) | 1611909603_Contraceptives' chart (1) (1).pdf | 2021-01-29 14:10 | 544K | |
![[ ]](/icons/layout.gif) | 1630325572_Assignment 1.pdf | 2021-08-30 17:42 | 503K | |
![[ ]](/icons/layout.gif) | 1630997292_Assignment 3.pdf | 2021-09-07 12:18 | 472K | |
![[ ]](/icons/layout.gif) | Reasons Why Women Have Induced Abortions- Evidence from 27 Countries.pdf | 2021-01-12 18:29 | 464K | |
![[ ]](/icons/unknown.gif) | 1612279405_Links to Articles.docx | 2021-02-02 20:53 | 449K | |
![[ ]](/icons/unknown.gif) | 1611730943_Links to videos.docx | 2021-01-27 12:32 | 448K | |
![[ ]](/icons/unknown.gif) | Additional source link.docx | 2021-01-12 18:06 | 448K | |
![[ ]](/icons/layout.gif) | Global consequences of unsafe abortion.pdf | 2021-01-13 13:28 | 442K | |
![[ ]](/icons/layout.gif) | 1631464587_Assignment 3- Legal Aspects and Discourse around abortion.pdf | 2021-09-12 22:06 | 418K | |
![[ ]](/icons/layout.gif) | 1631631538_Assignment 4- Interlink of the MTP Act with the POCSO and PCPNDT Acts.pdf | 2021-09-14 20:28 | 409K | |
![[IMG]](/icons/image2.gif) | 1635081936_user_IMG_20210508_141140.jpg | 2021-10-24 18:55 | 398K | |
![[IMG]](/icons/image2.gif) | 1610538255_user_IMG-20210107-WA0015.jpeg | 2021-01-13 17:14 | 375K | |
![[ ]](/icons/unknown.gif) | 1635657721_Assignment - TYPF Course - Module 4, Lesson 2.pages | 2021-10-31 10:52 | 373K | |
![[ ]](/icons/layout.gif) | 1630560970_Assignment 1- Common myths and misconception.pdf | 2021-09-02 11:06 | 289K | |
![[ ]](/icons/layout.gif) | 1630607045_LESSON 2.pdf | 2021-09-02 23:54 | 265K | |
![[ ]](/icons/layout.gif) | 1611636679_YWALPBE13-YoungWomenandAbortionAvoidingLegalPolicyBarriers.pdf | 2021-01-26 10:21 | 263K | |
![[ ]](/icons/layout.gif) | 1630916285_Shilpa Shroff_Values Clarification_PPT (1).pdf | 2021-09-06 13:48 | 245K | |
![[ ]](/icons/layout.gif) | 1612453274_Assignment 2_Biraja.pdf | 2021-02-04 21:11 | 240K | |
![[ ]](/icons/layout.gif) | 1612449076_Assignment 1_Biraja.pdf | 2021-02-04 20:01 | 239K | |
![[ ]](/icons/layout.gif) | 1611636679_Abortion Policy in India- Lacunae and Future Challenges.pdf | 2021-01-26 10:21 | 209K | |
![[ ]](/icons/layout.gif) | 1630607603_Assignment 2- Type of Contraceptive.pdf | 2021-09-03 00:03 | 208K | |
![[IMG]](/icons/image2.gif) | 1612235875_Screenshot_20210201-173344_Chrome.jpg | 2021-02-02 08:47 | 203K | |
![[IMG]](/icons/image2.gif) | 1630346419_user_IMG-20190909-WA0023.jpg | 2021-08-30 23:30 | 191K | |
![[IMG]](/icons/image2.gif) | 1610538287_user_IMG_20210107_173603_327.jpg | 2021-01-13 17:14 | 186K | |
![[ ]](/icons/layout.gif) | 1612280078_Unsafe abortion- the preventable pandemic (1).pdf | 2021-02-02 21:04 | 179K | |
![[IMG]](/icons/image2.gif) | 1610457049_course_Abortion Icon.png | 2021-01-12 18:40 | 176K | |
![[IMG]](/icons/image2.gif) | 1610457013_course_Abortion Icon.png | 2021-01-12 18:40 | 176K | |
![[IMG]](/icons/image2.gif) | 1616409883_user_Shruti Das.jpeg | 2021-03-22 16:14 | 175K | |
![[IMG]](/icons/image2.gif) | 1616409853_user_Shruti Das.jpeg | 2021-03-22 16:14 | 175K | |
![[IMG]](/icons/image2.gif) | 1630302469_user_IMG_20210421_192508_745.jpg | 2021-08-30 11:17 | 163K | |
![[IMG]](/icons/image2.gif) | 1629954990_faculty_Profile Photo.jpg | 2021-08-26 10:46 | 154K | |
![[ ]](/icons/layout.gif) | 1614797751_Chapter 9 - Call To Action and Guiding Principles for Advocacy [Downloadable].pdf | 2021-03-04 00:25 | 146K | |
![[IMG]](/icons/image2.gif) | 1635075503_user_aloe.jpeg | 2021-10-24 17:08 | 145K | |
![[IMG]](/icons/image2.gif) | 1630346443_user_IMG-20191101-WA0078.jpg | 2021-08-30 23:30 | 145K | |
![[IMG]](/icons/image2.gif) | 1610461614_user_FB_IMG_1528806582057.jpg | 2021-01-12 19:56 | 140K | |
![[IMG]](/icons/image2.gif) | 1610461575_user_FB_IMG_1528806582057.jpg | 2021-01-12 19:56 | 140K | |
![[IMG]](/icons/image2.gif) | 1635082046_user_IMG_20210517_123054_145.jpg | 2021-10-24 18:57 | 129K | |
![[ ]](/icons/layout.gif) | 1611392015_Assingnment-converted.pdf | 2021-01-23 14:23 | 116K | |
![[ ]](/icons/layout.gif) | 1635055198_Assignment - TYPF_Module 3, Lesson 2 - Ananya Iyer.pdf | 2021-10-24 11:29 | 115K | |
![[ ]](/icons/layout.gif) | 1616483528_Myths around Abortion - Response Paper.pdf | 2021-03-23 12:42 | 109K | |
![[ ]](/icons/layout.gif) | 1612466448_Assignment_3_Biraja.pdf | 2021-02-05 00:50 | 106K | |
![[ ]](/icons/layout.gif) | 1615530756_Lesson 2-assignment-abortion- module 2.pdf | 2021-03-12 12:02 | 97K | |
![[ ]](/icons/layout.gif) | 1633422534_Module 3 Lesson 3 Assignment.pdf | 2021-10-05 13:58 | 94K | |
![[ ]](/icons/layout.gif) | 1635657737_Assignment - TYPF Course - Module 4, Lesson 2 - Ananya Iyer.pdf | 2021-10-31 10:52 | 83K | |
![[ ]](/icons/layout.gif) | 1633422378_Module 3 Lesson 2 Assignment.pdf | 2021-10-05 13:56 | 81K | |
![[ ]](/icons/layout.gif) | 1635174526_Assignment - TYPF_Module 3, Lesson 3 - Ananya Iyer.pdf | 2021-10-25 20:38 | 80K | |
![[ ]](/icons/layout.gif) | 1613972196_Module 3, assignment 3- Bhavna G. verma.pdf | 2021-02-22 11:06 | 75K | |
![[IMG]](/icons/image2.gif) | 1616147410_course_logo1.1.png | 2021-03-19 15:20 | 74K | |
![[ ]](/icons/layout.gif) | 1615530839_Post-module 2 assignment_Bhavna_Delhi.pdf | 2021-03-12 12:03 | 73K | |
![[ ]](/icons/unknown.gif) | 1619871911_WorkplanTemplate.docx | 2021-05-01 17:55 | 71K | |
![[ ]](/icons/layout.gif) | 1615732669_Module 4- assignment 2.pdf | 2021-03-14 20:07 | 70K | |
![[ ]](/icons/layout.gif) | 1612874476_Untitled document(6).pdf | 2021-02-09 18:11 | 70K | |
![[IMG]](/icons/image2.gif) | 1630660272_user_IMAGE.jpg | 2021-09-03 14:41 | 68K | |
![[ ]](/icons/layout.gif) | 1632686154_TYPF Couse - Post Module Assignment - Module 2 - Ananya Iyer.pdf | 2021-09-27 01:25 | 67K | |
![[IMG]](/icons/image2.gif) | 1611899488_course_ehkäisyvälineet.png | 2021-01-29 11:21 | 66K | |
![[IMG]](/icons/image2.gif) | 1611899091_course_ehkäisyvälineet.png | 2021-01-29 11:14 | 66K | |
![[IMG]](/icons/image2.gif) | 1611898577_course_ehkäisyvälineet.png | 2021-01-29 11:06 | 66K | |
![[IMG]](/icons/image2.gif) | 1611897414_course_ehkäisyvälineet.png | 2021-01-29 10:46 | 66K | |
![[IMG]](/icons/image2.gif) | 1611897386_course_ehkäisyvälineet.png | 2021-01-29 10:46 | 66K | |
![[IMG]](/icons/image2.gif) | 1611897231_course_ehkäisyvälineet.png | 2021-01-29 10:43 | 66K | |
![[IMG]](/icons/image2.gif) | 1611895314_course_ehkäisyvälineet (1).png | 2021-01-29 10:11 | 66K | |
![[IMG]](/icons/image2.gif) | 1611895256_course_ehkäisyvälineet (1).png | 2021-01-29 10:10 | 66K | |
![[IMG]](/icons/image2.gif) | 1611895140_course_ehkäisyvälineet (1).png | 2021-01-29 10:09 | 66K | |
![[IMG]](/icons/image2.gif) | 1611895130_course_ehkäisyvälineet (1).png | 2021-01-29 10:08 | 66K | |
![[IMG]](/icons/image2.gif) | 1611895117_course_ehkäisyvälineet (1).png | 2021-01-29 10:08 | 66K | |
![[IMG]](/icons/image2.gif) | 1611895044_course_ehkäisyvälineet.png | 2021-01-29 10:07 | 66K | |
![[ ]](/icons/layout.gif) | 1631456005_TYPF - Abortion Course - Lesson 2, Module 2 - Ananya Iyer.pdf | 2021-09-12 19:43 | 65K | |
![[ ]](/icons/layout.gif) | 1615931228_Untitled document (2).pdf | 2021-03-17 03:17 | 65K | |
![[ ]](/icons/layout.gif) | 1631694503_Lesson 3 - Module 2 - TYPF Course - Ananya Iyer.pdf | 2021-09-15 13:58 | 65K | |
![[ ]](/icons/layout.gif) | 1611304911_Response paper- abortion myths and misconceptions_Bhavna.pdf | 2021-01-22 14:11 | 64K | |
![[ ]](/icons/layout.gif) | 1614933768_Post module 4 assignment- Bhavna.pdf | 2021-03-05 14:12 | 64K | |
![[IMG]](/icons/image2.gif) | 1630562226_user_IMG_20200616_174719.jpg | 2021-09-02 11:27 | 64K | |
![[ ]](/icons/unknown.gif) | 1620167200_Workplan Template.docx | 2021-05-05 03:56 | 62K | |
![[ ]](/icons/unknown.gif) | 1620167153_Workplan Template.docx | 2021-05-05 03:55 | 62K | |
![[ ]](/icons/layout.gif) | 1615232387_ASSIGNMENT lesson 2.pdf | 2021-03-09 01:09 | 62K | |
![[ ]](/icons/layout.gif) | 1630635684_TYPF - Module 1 - Lesson 2..pdf | 2021-09-03 07:51 | 62K | |
![[ ]](/icons/layout.gif) | 1630635613_TYPF - Module 1 - Lesson 2.pdf | 2021-09-03 07:50 | 62K | |
![[ ]](/icons/unknown.gif) | 1624997093_1617083840_WorkplanTemplate (1).docx | 2021-06-30 01:34 | 62K | |
![[ ]](/icons/layout.gif) | 1630643488_TYPF - Module 1 - Lesson 3.pdf | 2021-09-03 10:01 | 61K | |
![[ ]](/icons/unknown.gif) | 1623510650_Advocacy Worksheet_ Aashiana Thiyam.docx | 2021-06-12 20:40 | 61K | |
![[ ]](/icons/layout.gif) | 1615717494_Module 3 Assignment 2.pdf | 2021-03-14 15:54 | 61K | |
![[ ]](/icons/layout.gif) | 1613221121_Module 2, Assignment 3.pdf | 2021-02-13 18:28 | 60K | |
![[ ]](/icons/unknown.gif) | 1623669261_1617083840_WorkplanTemplate (1) (1).docx | 2021-06-14 16:44 | 60K | |
![[IMG]](/icons/image2.gif) | 1630602140_user_pp1.jpg | 2021-09-02 22:32 | 59K | |
![[ ]](/icons/unknown.gif) | 1623513279_1617083840_WorkplanTemplate.docx | 2021-06-12 21:24 | 59K | |
![[ ]](/icons/layout.gif) | 1635676361_Post Module Assignment - TYPF Course - Ananya Iyer.pdf | 2021-10-31 16:02 | 59K | |
![[ ]](/icons/layout.gif) | 1613278718_Module 3, assignment 1.pdf | 2021-02-14 10:28 | 57K | |
![[ ]](/icons/layout.gif) | 1611307954_Understanding Abortion and Contraception Lesson 2 - Assignment.pdf | 2021-01-22 15:02 | 56K | |
![[ ]](/icons/layout.gif) | 1612421917_Chap 5 Download.pdf | 2021-02-04 12:28 | 56K | |
![[IMG]](/icons/image2.gif) | 1630302341_user_IMG-20210829-WA0007.jpg | 2021-08-30 11:15 | 55K | |
![[ ]](/icons/layout.gif) | 1612024006_Terms_Chap3 (1).pdf | 2021-01-30 21:56 | 53K | |
![[ ]](/icons/layout.gif) | 1611300658_Untitled document(4).pdf | 2021-01-22 13:00 | 53K | |
![[ ]](/icons/unknown.gif) | 1623999684_Rupal. advocacy. WorkplanTemplate.docx | 2021-06-18 12:31 | 53K | |
![[ ]](/icons/layout.gif) | 1630574721_Module 1_ Lesson 3 - Assignment.pdf | 2021-09-02 14:55 | 51K | |
![[ ]](/icons/unknown.gif) | 1617083840_WorkplanTemplate.docx | 2021-03-30 11:27 | 51K | |
![[ ]](/icons/layout.gif) | 1631780855_Lesson 2 - Assignment.pdf | 2021-09-16 13:57 | 48K | |
![[IMG]](/icons/image2.gif) | 1631645217_user_IMG-20210411-WA0001.jpg | 2021-09-15 00:16 | 48K | |
![[ ]](/icons/unknown.gif) | 1621180550_worksheet.docx | 2021-05-16 21:25 | 48K | |
![[ ]](/icons/unknown.gif) | 1621179790_worksheet.docx | 2021-05-16 21:13 | 48K | |
![[ ]](/icons/layout.gif) | 1611222538_Untitled document.pdf | 2021-01-21 15:18 | 47K | |
![[ ]](/icons/unknown.gif) | 1618222800_1617083840_WorkplanTemplate.docx | 2021-04-12 15:50 | 47K | |
![[IMG]](/icons/image2.gif) | 1610472651_user_kuhoo tiwari.jpeg | 2021-01-12 23:00 | 45K | |
![[ ]](/icons/layout.gif) | 1631786302_Post- module assignment - Assignment.pdf | 2021-09-16 15:28 | 45K | |
![[ ]](/icons/layout.gif) | 1613863864_MTP.pdf | 2021-02-21 05:01 | 44K | |
![[ ]](/icons/layout.gif) | 1633460722_TYPF Assignment 1.pdf | 2021-10-06 00:35 | 41K | |
![[ ]](/icons/layout.gif) | 1611320923_Post module 1 assignment- Bhavna.pdf | 2021-01-22 18:38 | 40K | |
![[ ]](/icons/unknown.gif) | 1611140164_Medicinewise_Sales_Reports (2).xls | 2021-01-20 16:26 | 38K | |
![[ ]](/icons/unknown.gif) | 1611140137_Medicinewise_Sales_Reports (2).xls | 2021-01-20 16:25 | 38K | |
![[ ]](/icons/unknown.gif) | 1611140062_Medicinewise_Sales_Reports (2).xls | 2021-01-20 16:24 | 38K | |
![[ ]](/icons/unknown.gif) | 1611140046_Medicinewise_Sales_Reports (2).xls | 2021-01-20 16:24 | 38K | |
![[ ]](/icons/unknown.gif) | 1611140013_Medicinewise_Sales_Reports (2).xls | 2021-01-20 16:23 | 38K | |
![[ ]](/icons/unknown.gif) | 1611140004_Medicinewise_Sales_Reports (2).xls | 2021-01-20 16:23 | 38K | |
![[ ]](/icons/unknown.gif) | 1611136425_Medicinewise_Sales_Reports (2).xls | 2021-01-20 15:23 | 38K | |
![[ ]](/icons/layout.gif) | 1630489829_Sanskriti_ResponsePaper1.pdf | 2021-09-01 15:20 | 38K | |
![[IMG]](/icons/image2.gif) | 1630660083_user_Photo- Akriti Das.jpg | 2021-09-03 14:38 | 37K | |
![[IMG]](/icons/image2.gif) | 1630660030_user_Photo- Akriti Das.jpg | 2021-09-03 14:37 | 37K | |
![[ ]](/icons/layout.gif) | 1611300557_Untitled document(3)-1.pdf | 2021-01-22 12:59 | 37K | |
![[ ]](/icons/layout.gif) | 1633269200_Question and answer .pdf | 2021-10-03 19:23 | 33K | |
![[ ]](/icons/layout.gif) | 1635054275_Post Module 4 Assignment.pdf | 2021-10-24 11:14 | 31K | |
![[ ]](/icons/layout.gif) | 1632750220_Questions.pdf | 2021-09-27 19:13 | 31K | |
![[ ]](/icons/layout.gif) | 1631653698_Abortion laws.pdf | 2021-09-15 02:38 | 31K | |
![[ ]](/icons/layout.gif) | 1633264348_Unpregnant.pdf | 2021-10-03 18:02 | 30K | |
![[ ]](/icons/unknown.gif) | 1632737534_5 questions.doc | 2021-09-27 15:42 | 30K | |
![[ ]](/icons/layout.gif) | 1631484164_Mtp.pdf | 2021-09-13 03:32 | 28K | |
![[ ]](/icons/layout.gif) | women_who_have_abortions.pdf | 2021-01-12 18:29 | 28K | |
![[ ]](/icons/unknown.gif) | 1632819216_7 questions.doc | 2021-09-28 14:23 | 28K | |
![[ ]](/icons/layout.gif) | 1632741065_Abortion clinics in noida.pdf | 2021-09-27 16:41 | 28K | |
![[ ]](/icons/unknown.gif) | 1632733391_Analyze access to abortion centre.doc | 2021-09-27 14:33 | 27K | |
![[IMG]](/icons/image2.gif) | 1628833833_course_1626775757_course_SAAF logo.jpg | 2021-08-13 11:20 | 26K | |
![[ ]](/icons/layout.gif) | 1631484131_Mtp, posco.pdf | 2021-09-13 03:32 | 25K | |
![[IMG]](/icons/image2.gif) | 1629370334_course_1622625807_course_SAAF logo.jpg | 2021-08-19 16:22 | 24K | |
![[ ]](/icons/unknown.gif) | 1622983137_Sangeetha_WorkplanTemplate.docx | 2021-06-06 18:08 | 24K | |
![[ ]](/icons/layout.gif) | 1632742408_People who can access abortion easily .pdf | 2021-09-27 17:03 | 23K | |
![[IMG]](/icons/image2.gif) | 1611895553_course_WhatsApp Image 2021-01-29 at 10.13.10 AM.jpeg | 2021-01-29 10:15 | 21K | |
![[ ]](/icons/unknown.gif) | 1613651059_Assignment7.Rupal.docx | 2021-02-18 17:54 | 20K | |
![[ ]](/icons/unknown.gif) | 1627227402_Reproductive rights.docx | 2021-07-25 21:06 | 19K | |
![[ ]](/icons/unknown.gif) | 1611316192_Abortion Myth Assignment.docx | 2021-01-22 17:19 | 18K | |
![[ ]](/icons/unknown.gif) | 1619156071_Assignment12-Rupal-Advocacy1.docx | 2021-04-23 11:04 | 18K | |
![[ ]](/icons/unknown.gif) | 1612170722_Module 2, Lesson 2 Assignment.docx | 2021-02-01 14:42 | 18K | |
![[ ]](/icons/unknown.gif) | 1622063611_Lesson 2 assignment.docx | 2021-05-27 02:43 | 17K | |
![[ ]](/icons/unknown.gif) | 1631466065_Assignment.docx | 2021-09-12 22:31 | 17K | |
![[ ]](/icons/unknown.gif) | 1612864721_Lesson 3 - Assignment.docx | 2021-02-09 15:28 | 17K | |
![[ ]](/icons/unknown.gif) | 1635010251_Assignment.docx | 2021-10-23 23:00 | 17K | |
![[ ]](/icons/unknown.gif) | 1614239347_find my method assignment.docx | 2021-02-25 13:19 | 17K | |
![[ ]](/icons/unknown.gif) | 1622323586_ഗർഭച്ഛിദ്ര സേവനങ്ങളുടെ പ്രാപ്യത.docx | 2021-05-30 02:56 | 17K | |
![[ ]](/icons/unknown.gif) | 1613650948_Assignment8.Rupal.docx | 2021-02-18 17:52 | 17K | |
![[ ]](/icons/unknown.gif) | 1633878376_Assignment.docx | 2021-10-10 20:36 | 17K | |
![[ ]](/icons/unknown.gif) | 1630566797_YP Fellowship Assignment 3.docx | 2021-09-02 12:43 | 16K | |
![[ ]](/icons/unknown.gif) | 1612025199_Module 2 Lesson 2.docx | 2021-01-30 22:16 | 16K | |
![[ ]](/icons/unknown.gif) | 1631685260_Assignment on Legal aspects of Abortion.docx | 2021-09-15 11:24 | 16K | |
![[ ]](/icons/unknown.gif) | 1633888360_Assignment.docx | 2021-10-10 23:22 | 16K | |
![[ ]](/icons/unknown.gif) | 1634477544_Assignment.docx | 2021-10-17 19:02 | 16K | |
![[ ]](/icons/unknown.gif) | 1634477474_Assignment #4.docx | 2021-10-17 19:01 | 16K | |
![[ ]](/icons/unknown.gif) | 1634477163_Assignment #4.docx | 2021-10-17 18:56 | 16K | |
![[ ]](/icons/unknown.gif) | 1634477111_Assignment #4.docx | 2021-10-17 18:55 | 16K | |
![[ ]](/icons/unknown.gif) | 1634477081_Assignment #4.docx | 2021-10-17 18:54 | 16K | |
![[ ]](/icons/unknown.gif) | 1611425033_Abortions are unsafe.docx | 2021-01-23 23:33 | 16K | |
![[ ]](/icons/unknown.gif) | 1612071774_Assignment4.Rupal.docx | 2021-01-31 11:12 | 16K | |
![[ ]](/icons/unknown.gif) | 1612065725_Assignment4.Rupal.docx | 2021-01-31 09:32 | 16K | |
![[ ]](/icons/unknown.gif) | 1617729182_find my method assignment.docx | 2021-04-06 22:43 | 16K | |
![[ ]](/icons/unknown.gif) | 1633872296_Assignment.docx | 2021-10-10 18:54 | 15K | |
![[ ]](/icons/unknown.gif) | 1631682809_Assignment on Legal aspects of Abortion.docx | 2021-09-15 10:43 | 15K | |
![[ ]](/icons/unknown.gif) | 1634474496_Assignment.docx | 2021-10-17 18:11 | 15K | |
![[ ]](/icons/unknown.gif) | 1613651175_Assignment10.Rupal.docx | 2021-02-18 17:56 | 15K | |
![[ ]](/icons/unknown.gif) | 1623868993_Worksheet 1.docx | 2021-06-17 00:13 | 15K | |
![[ ]](/icons/unknown.gif) | 1614154611_find my method assignment.docx | 2021-02-24 13:46 | 15K | |
![[ ]](/icons/unknown.gif) | 1631470098_Assignment.docx | 2021-09-12 23:38 | 15K | |
![[ ]](/icons/unknown.gif) | 1617791772_find my method assignment.docx | 2021-04-07 16:06 | 15K | |
![[ ]](/icons/unknown.gif) | 1617728633_find my method assignment.docx | 2021-04-06 22:33 | 15K | |
![[ ]](/icons/unknown.gif) | 1613674259_USA INDIA.docx | 2021-02-19 00:20 | 15K | |
![[ ]](/icons/unknown.gif) | 1630915473_Assignment.docx | 2021-09-06 13:34 | 15K | |
![[ ]](/icons/unknown.gif) | 1618475193_Chapter 1 - Worksheet.docx | 2021-04-15 13:56 | 15K | |
![[ ]](/icons/unknown.gif) | 1612073142_Assg.2.docx | 2021-01-31 11:35 | 15K | |
![[ ]](/icons/unknown.gif) | 1623511266_Abortion law USA INDIA.docx | 2021-06-12 20:51 | 15K | |
![[ ]](/icons/unknown.gif) | 1613922712_Post-module assignment - Assignment.docx | 2021-02-21 21:21 | 15K | |
![[ ]](/icons/unknown.gif) | 1613121919_ASSIGNMENT 1- module 3.docx | 2021-02-12 14:55 | 14K | |
![[ ]](/icons/unknown.gif) | 1632214520_YP foundation assignment.docx | 2021-09-21 14:25 | 14K | |
![[ ]](/icons/unknown.gif) | 1630592069_Assignment_myths around abortion.docx | 2021-09-02 19:44 | 14K | |
![[ ]](/icons/unknown.gif) | 1611235881_Right based argument for abortion.docx | 2021-01-21 19:01 | 14K | |
![[ ]](/icons/unknown.gif) | 1611235808_Right based argument for abortion.docx | 2021-01-21 19:00 | 14K | |
![[ ]](/icons/unknown.gif) | 1631136388_TYPF_M2L2_AroshiVij.docx | 2021-09-09 02:56 | 14K | |
![[ ]](/icons/unknown.gif) | 1630597979_Assignment #3.docx | 2021-09-02 21:22 | 14K | |
![[ ]](/icons/layout.gif) | 1630593985_Myths about Abortion.pdf | 2021-09-02 20:16 | 14K | |
![[ ]](/icons/unknown.gif) | 1637259857_Abortion rights comparison.docx | 2021-11-18 23:54 | 14K | |
![[ ]](/icons/unknown.gif) | 1613651005_Assignment9.Rupal.docx | 2021-02-18 17:53 | 14K | |
![[ ]](/icons/unknown.gif) | 1631367189_Assignment_legal aspects of abortion.docx | 2021-09-11 19:03 | 14K | |
![[ ]](/icons/unknown.gif) | 1630602134_Assignment #2.docx | 2021-09-02 22:32 | 14K | |
![[ ]](/icons/unknown.gif) | 1611323575_Abortion Myth.docx | 2021-01-22 19:22 | 14K | |
![[ ]](/icons/unknown.gif) | 1612000952_ASSIGNMENT 1 - module 2.docx | 2021-01-30 15:32 | 14K | |
![[ ]](/icons/unknown.gif) | 1612180749_Post-Module Assignment.docx | 2021-02-01 17:29 | 14K | |
![[ ]](/icons/unknown.gif) | 1612165689_Lesson 3 - Assignment.docx | 2021-02-01 13:18 | 14K | |
![[ ]](/icons/unknown.gif) | 1616182956_New Microsoft Office Word Document (5).docx | 2021-03-20 01:12 | 13K | |
![[ ]](/icons/unknown.gif) | 1611339352_ASSIGNMENT 1.docx | 2021-01-22 23:45 | 13K | |
![[ ]](/icons/unknown.gif) | 1631512822_assignemtn 2.docx | 2021-09-13 11:30 | 13K | |
![[ ]](/icons/unknown.gif) | 1613661324_Assignment11.Rupal.docx | 2021-02-18 20:45 | 13K | |
![[ ]](/icons/unknown.gif) | 1630912172_assignement.docx | 2021-09-06 12:39 | 13K | |
![[ ]](/icons/unknown.gif) | 1628759216_myths around abortion.docx | 2021-08-12 14:36 | 13K | |
![[ ]](/icons/unknown.gif) | 1630253553_YP Foundation Assignment 1.docx | 2021-08-29 21:42 | 13K | |
![[ ]](/icons/unknown.gif) | 1611339787_MYTHS SURROUNDING ABORTION.docx | 2021-01-22 23:53 | 13K | |
![[ ]](/icons/unknown.gif) | 1611389650_Argument for the myth only young and irresponsible women seek abortion.docx | 2021-01-23 13:44 | 13K | |
![[ ]](/icons/unknown.gif) | 1611304800_ASSIGNMENT 1.docx | 2021-01-22 14:10 | 13K | |
![[ ]](/icons/unknown.gif) | 1612957653_Lesson 2 - Assignment.docx | 2021-02-10 17:17 | 13K | |
![[ ]](/icons/unknown.gif) | 1611555863_Module 1- Lesson 2 Assignment.docx | 2021-01-25 11:54 | 13K | |
![[ ]](/icons/unknown.gif) | 1616263740_New Microsoft Office Word Document (7).docx | 2021-03-20 23:39 | 13K | |
![[ ]](/icons/unknown.gif) | 1630486761_Assignment on Abortion-Myths.docx | 2021-09-01 14:29 | 13K | |
![[ ]](/icons/unknown.gif) | 1634968451_Assignment_ access to abortion ghy.docx | 2021-10-23 11:24 | 13K | |
![[ ]](/icons/unknown.gif) | 1614149674_find my method assignment.docx | 2021-02-24 12:24 | 13K | |
![[ ]](/icons/unknown.gif) | 1630670199_Assignment 1.docx | 2021-09-03 17:26 | 13K | |
![[ ]](/icons/unknown.gif) | 1630670175_Assignment 1.docx | 2021-09-03 17:26 | 13K | |
![[ ]](/icons/unknown.gif) | 1633886575_Assignment.docx | 2021-10-10 22:52 | 13K | |
![[ ]](/icons/unknown.gif) | 1614509950_Module 4, Lesson 2 - Assignment.docx | 2021-02-28 16:29 | 13K | |
![[ ]](/icons/unknown.gif) | 1612090085_Assignment6.Rupal.docx | 2021-01-31 16:18 | 13K | |
![[ ]](/icons/unknown.gif) | 1611338855_Assignment2.Rupal.docx | 2021-01-22 23:37 | 12K | |
![[ ]](/icons/unknown.gif) | 1611338734_Assignment1.Rupal.docx | 2021-01-22 23:35 | 12K | |
![[ ]](/icons/unknown.gif) | 1630562438_YP Assigment 2.docx | 2021-09-02 11:30 | 12K | |
![[ ]](/icons/unknown.gif) | 1612077787_Assignment5.Rupal.docx | 2021-01-31 12:53 | 12K | |
![[ ]](/icons/unknown.gif) | 1612864619_Lesson 1 - Assignment.docx | 2021-02-09 15:26 | 12K | |
![[ ]](/icons/unknown.gif) | 1616173420_New Microsoft Word Document.docx | 2021-03-19 22:33 | 12K | |
![[ ]](/icons/unknown.gif) | 1611322385_ASSIGNMENT 3.docx | 2021-01-22 19:03 | 12K | |
![[ ]](/icons/unknown.gif) | 1630646609_Assignment_quiz.docx | 2021-09-03 10:53 | 12K | |
![[ ]](/icons/unknown.gif) | 1611556120_Module 1 Post module assignment.docx | 2021-01-25 11:58 | 12K | |
![[ ]](/icons/unknown.gif) | 1611217315_Two myths and misconceptions around abortion..docx | 2021-01-21 13:51 | 12K | |
![[ ]](/icons/unknown.gif) | 1611555981_Module 1, Lessson 3.docx | 2021-01-25 11:56 | 12K | |
![[ ]](/icons/unknown.gif) | 1611340895_postModuleAssignment.Rupal.docx | 2021-01-23 00:11 | 12K | |
![[ ]](/icons/unknown.gif) | 1611343084_Post-module Assignment.docx | 2021-01-23 00:48 | 12K | |
![[ ]](/icons/unknown.gif) | 1611353719_Contraception Assignment_Madhubanti.docx | 2021-01-23 03:45 | 12K | |
![[ ]](/icons/unknown.gif) | 1612262801_ASSIGNMENT 2 - module 2.docx | 2021-02-02 16:16 | 12K | |
![[ ]](/icons/unknown.gif) | 1632407539_Assignment_reflective piece.docx | 2021-09-23 20:02 | 11K | |
![[ ]](/icons/unknown.gif) | 1611322489_Assignment 1.docx | 2021-01-22 19:04 | 11K | |
![[ ]](/icons/unknown.gif) | 1610967671_Assignment 1.docx | 2021-01-18 16:31 | 11K | |
![[ ]](/icons/unknown.gif) | 1611215532_Two myths and misconceptions around abortion..docx | 2021-01-21 13:22 | 11K | |
![[ ]](/icons/unknown.gif) | 1630605143_MYTHS ABOUT ABORTION.docx | 2021-09-02 23:22 | 11K | |
![[ ]](/icons/unknown.gif) | 1632301711_Assignment 1 - Chhavi Saxena.docx | 2021-09-22 14:38 | 10K | |
![[ ]](/icons/unknown.gif) | 1611214906_Two myths and misconceptions around abortion..docx | 2021-01-21 13:11 | 10K | |
![[ ]](/icons/layout.gif) | 1635047051_Module 3 Lesson 1 Assignment.pdf | 2021-10-24 09:14 | 10K | |
![[ ]](/icons/unknown.gif) | 1630607883_CONTRACEPTIVES.docx | 2021-09-03 00:08 | 10K | |
![[ ]](/icons/unknown.gif) | 1611323450_Quiz Assignment.docx | 2021-01-22 19:20 | 10K | |
![[ ]](/icons/unknown.gif) | 1611323384_Quiz Assignment.docx | 2021-01-22 19:19 | 10K | |
![[ ]](/icons/unknown.gif) | 1635962145_Post-module assignment - Post - module assignment.docx | 2021-11-03 23:25 | 8.9K | |
![[ ]](/icons/unknown.gif) | 1632216300_Module - 3, Assignment - 3 .docx | 2021-09-21 14:55 | 8.7K | |
![[ ]](/icons/unknown.gif) | 1615434610_Untitled document (5).docx | 2021-03-11 09:20 | 8.6K | |
![[ ]](/icons/unknown.gif) | 1631271156_Arpita Singh, Module - 2, Assignment - 1.docx | 2021-09-10 16:22 | 8.5K | |
![[ ]](/icons/unknown.gif) | 1631611131_Arpita Singh, Module - 3, Assignment -1.docx | 2021-09-14 14:48 | 8.3K | |
![[ ]](/icons/unknown.gif) | 1634840859_Arpita Singh_ Module 4, Assigment 1.docx | 2021-10-21 23:57 | 8.1K | |
![[ ]](/icons/unknown.gif) | 1634902075_Arpita Singh; Module – 4, Assignment – 2.docx | 2021-10-22 16:57 | 7.9K | |
![[ ]](/icons/unknown.gif) | 1611512015_Myth Promiscuity and Irresponsibity is the Reason for Abortion.docx | 2021-01-24 23:43 | 7.2K | |
![[IMG]](/icons/image2.gif) | 1616147410_course_sign.png | 2021-03-19 15:20 | 6.5K | |
![[IMG]](/icons/image2.gif) | 1626775757_course_DrSouvikPyneSignature.jpg | 2021-07-20 15:39 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1622457566_course_DrSouvikPyneSignature.jpg | 2021-05-31 16:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1628833833_course_1626775757_course_DrSouvikPyneSignature.jpg | 2021-08-13 11:20 | 2.5K | |
![[IMG]](/icons/image2.gif) | 1629370334_course_1622457566_course_DrSouvikPyneSignature.jpg | 2021-08-19 16:22 | 1.9K | |
![[ ]](/icons/unknown.gif) | 1611140164_download.xls | 2021-01-20 16:26 | 271 | |
![[ ]](/icons/unknown.gif) | 1611140164_Medicinewise_Sales_Reports (1).xls | 2021-01-20 16:26 | 271 | |
![[ ]](/icons/unknown.gif) | 1611140137_Medicinewise_Sales_Reports (1).xls | 2021-01-20 16:25 | 271 | |
![[ ]](/icons/unknown.gif) | 1611140062_Medicinewise_Sales_Reports (1).xls | 2021-01-20 16:24 | 271 | |
![[ ]](/icons/unknown.gif) | 1611140056_download.xls | 2021-01-20 16:24 | 271 | |
![[ ]](/icons/unknown.gif) | 1611140046_download.xls | 2021-01-20 16:24 | 271 | |
![[ ]](/icons/unknown.gif) | 1611140046_Medicinewise_Sales_Reports (1).xls | 2021-01-20 16:24 | 271 | |
![[ ]](/icons/unknown.gif) | 1611136425_Medicinewise_Sales_Reports (1).xls | 2021-01-20 15:23 | 271 | |
![[DIR]](/icons/folder.gif) | thumbnail/ | 2021-10-24 18:57 | - | |
|